CAS 7295-46-7

4-Bromohexanophenone

Description:

4-Bromohexanophenone, with the CAS number 7295-46-7, is an organic compound that belongs to the class of ketones. It features a bromine atom attached to a hexane chain, which is further connected to a phenone group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is characterized by its molecular structure, which includes a carbonyl group (C=O) that is central to its reactivity and properties. 4-Bromohexanophenone is known for its potential applications in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in chemical reactions such as nucleophilic substitutions. Additionally, it may exhibit specific physical properties such as solubility in organic solvents and varying melting and boiling points, which are influenced by its molecular weight and structure. As with many organic compounds, safety precautions should be taken when handling 4-Bromohexanophenone due to its potential health hazards.

Formula: C₁₂H₁₅BrO

InChI: InChI=1/C12H15BrO/c1-2-3-4-5-12(14)10-6-8-11(13)9-7-10/h6-9H,2-5H2,1H3

SMILES: CCCCCC(=O)c1ccc(cc1)Br

Synonyms:

• 1-(4-Bromophenyl)-1-hexanone
• 1-(4-Bromophenyl)Hexan-1-One

4-Bromohexanophenone

CAS: 7295-46-7

Formula: C₁₂H₁₅BrO

Purity: 98%

Color and Shape: Solid

Molecular weight: 255.1509

Ref: IN-DA005D1J

4-Bromohexanophenone

CAS: 7295-46-7

4-Bromohexanophenone

Purity: 98%

Molecular weight: 255.15g/mol

Ref: 54-OR1042836

1-(4-BROMOPHENYL)HEXAN-1-ONE

CAS: 7295-46-7

Formula: C₁₂H₁₅BrO

Purity: 98%

Molecular weight: 255.155

Ref: 10-F538196

4-Bromophenylpentyl ketone

CAS: 7295-46-7

4-Bromophenylpentyl ketone is an organic compound that has been synthesised to produce analogues of lipoxin A4, a naturally occurring lipid mediator. Lipoxins are important in the regulation of inflammation and pain, and 4-Bromophenylpentyl ketone has been shown to be effective in the treatment of airway inflammation in animals. This molecule also inhibits the production of cytokines, which are important for cell signaling. As an epoxide, 4-Bromophenylpentyl ketone can be used as a deodorant or antiperspirant.

Formula: C₁₂H₁₅BrO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 255.15 g/mol

Ref: 3D-FB67394