CAS 72955-96-5

1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol

Description:

1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol, with the CAS number 72955-96-5, is a chemical compound characterized by its unique structure that includes an amino group, a propanol backbone, and a carbazole moiety. The presence of the carbazole ring contributes to its potential as a fluorescent or photonic material due to the aromatic nature of the structure, which can facilitate π-π stacking interactions. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its solubility and reactivity can be influenced by the functional groups present, particularly the amino and hydroxyl groups, which can participate in hydrogen bonding and other intermolecular interactions. Additionally, the compound's stability and behavior under different conditions, such as pH and temperature, are essential for its application in research and industry. Overall, 1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol represents a versatile structure with potential applications in organic synthesis and materials science.

Formula: C₁₅H₁₆N₂O₂

InChI: InChI=1S/C15H16N2O2/c16-8-10(18)9-19-14-7-3-6-13-15(14)11-4-1-2-5-12(11)17-13/h1-7,10,17-18H,8-9,16H2

InChI key: InChIKey=UUUATVREIARQHR-UHFFFAOYSA-N

SMILES: O(CC(CN)O)C1=C2C=3C(NC2=CC=C1)=CC=CC3

Synonyms:

• 1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol
• 2-Propanol, 1-amino-3-(9H-carbazol-4-yloxy)-

1-Amino-3-(9H-carbazol-4-yloxy)propan-2-ol

CAS: 72955-96-5

1-Amino-3-(9H-carbazol-4-yloxy)propan-2-ol

Formula: C₁₅H₁₆N₂O₂

Purity: ≥95%

Color and Shape: off-white to pale beige solid

Molecular weight: 256.30g/mol

Ref: 54-OR019106

1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol

Controlled Product

CAS: 72955-96-5

Formula: C₁₅H₁₆N₂O₂

Color and Shape: Neat

Molecular weight: 256.3

Ref: TR-A611075

1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol

CAS: 72955-96-5

Please enquire for more information about 1-Amino-3-(9H-carbazol-4-yloxy)-2-propanol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 256.3 g/mol

Ref: 3D-XCA95596

Carvedilol Impurity 4

CAS: 72955-96-5

Formula: C₁₅H₁₆N₂O₂

Molecular weight: 256.30

Ref: ST-EA-CP-C10019