CAS 72956-44-6
:2-(2-{[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino}ethoxy)phenol
Description:
2-(2-{[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino}ethoxy)phenol, with the CAS number 72956-44-6, is a complex organic compound characterized by its multi-functional structure. It features a carbazole moiety, which is known for its aromatic properties and potential applications in organic electronics and photonics. The presence of a phenolic group contributes to its potential as an antioxidant and its ability to form hydrogen bonds, enhancing solubility in various solvents. The compound also contains an ether linkage and an amino group, which may impart additional reactivity and influence its biological activity. Its hydroxyl groups suggest potential for interactions with biological systems, making it of interest in medicinal chemistry. Overall, this compound's unique structural features may lead to diverse applications in fields such as pharmaceuticals, materials science, and organic synthesis, although specific properties like solubility, melting point, and reactivity would require empirical measurement for precise characterization.
Formula:C23H24N2O4
InChI:InChI=1/C23H24N2O4/c26-16(14-24-12-13-28-21-10-4-3-9-20(21)27)15-29-22-11-5-8-19-23(22)17-6-1-2-7-18(17)25-19/h1-11,16,24-27H,12-15H2
SMILES:c1ccc2c(c1)c1c(cccc1OCC(CNCCOc1ccccc1O)O)[nH]2
Synonyms:- Phenol, 2-(2-((3-(9H-carbazol-4-yloxy)-2-hydroxypropyl)amino)ethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
O-Desmethylcarvedilol
CAS:O-Desmethylcarvedilol (Desmethylcarvedilol) is an active metabolite of Carvedilol, a non-selective β-adrenergic receptor (β-AR) antagonist. This compound inhibits store overload-induced calcium release in HEK293 cells expressing the RyR2 R4496C mutation (IC50= 7.62 µM). Additionally, O-Desmethylcarvedilol slows the increase in heart rate and prevents diastolic pressure reduction induced by Isoproterenol in conscious rabbits (ED50s = 32 and 5 µg/kg).Formula:C23H24N2O4Color and Shape:SolidMolecular weight:392.45O-Desmethyl Carvedilol
CAS:Formula:C23H24N2O4Color and Shape:Off-White To Gray SolidMolecular weight:392.46O-Desmethyl Carvedilol
CAS:Controlled ProductApplications A metabolite of Carvedilol (C184625), a nonselective β-adrenergic blocker with α1-blocking activity.
References Sponer, G., et al.: J. Cardiovasc. Pharmacol., 9, 317 (1987), Fujimaki, M., et al.: Xenobiotica, 20, 1025 (1990), Ruffolo, R., et al.: Eur. J. Clin. Pharmacol., 38, S82 (1990), Clohs, L., et al.: J. Pharm. Biomed. Anal., 31, 407 (2003),Formula:C23H24N2O4Color and Shape:NeatMolecular weight:392.45





