CAS 7296-67-5

4-(3-Chloropropyl)benzenesulfonyl chloride

Description:

4-(3-Chloropropyl)benzenesulfonyl chloride, with the CAS number 7296-67-5, is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a benzene ring substituted with a chloropropyl group and a sulfonyl chloride moiety, making it a versatile intermediate in the synthesis of various chemical entities. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and storage conditions. The presence of the sulfonyl chloride group imparts significant electrophilic character, allowing it to participate in nucleophilic substitution reactions, which are essential for the formation of sulfonamides and other derivatives. Additionally, this compound is sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding sulfonic acid. Proper safety precautions, including the use of personal protective equipment, are necessary when working with this substance due to its corrosive nature and potential health hazards.

Formula: C₉H₁₀Cl₂O₂S

InChI: InChI=1S/C9H10Cl2O2S/c10-7-1-2-8-3-5-9(6-4-8)14(11,12)13/h3-6H,1-2,7H2

InChI key: InChIKey=YKDXVAJHIMABPJ-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=CC=C(CCCCl)C=C1

Synonyms:

• 4-(3-Chloropropyl)benzenesulfonyl chloride
• Benzenesulfonyl chloride, 4-(3-chloropropyl)-
• Benzenesulfonyl chloride, p-(3-chloropropyl)-

4-(3-Chloropropyl)benzene-1-sulfonyl chloride

CAS: 7296-67-5

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₂O₂S

Purity: Min. 95%

Molecular weight: 253.14 g/mol

Ref: 3D-HAA29667