CAS 729610-18-8

(1R)-N-(1H-indol-2-ylmethyl)-1-naphthalen-1-ylethanamine hydrochloride

Description:

(1R)-N-(1H-indol-2-ylmethyl)-1-naphthalen-1-ylethanamine hydrochloride, with the CAS number 729610-18-8, is a chemical compound characterized by its complex structure, which includes an indole moiety and a naphthalene ring. This compound is typically classified as a selective serotonin receptor modulator, indicating its potential role in influencing serotonin pathways in biological systems. It is often studied for its pharmacological properties, particularly in the context of neuropharmacology and potential therapeutic applications. The hydrochloride salt form enhances its solubility in water, making it more suitable for biological assays and formulations. The compound's stereochemistry, indicated by the (1R) designation, suggests specific spatial arrangements that can significantly affect its biological activity and interaction with receptors. As with many compounds in medicinal chemistry, understanding its characteristics, including solubility, stability, and receptor affinity, is crucial for evaluating its potential uses in treating various conditions, particularly those related to mood and anxiety disorders.

Formula: C₂₁H₂₁ClN₂

InChI: InChI=1/C21H20N2.ClH/c1-15(19-11-6-9-16-7-2-4-10-20(16)19)22-14-18-13-17-8-3-5-12-21(17)23-18;/h2-13,15,22-23H,14H2,1H3;1H/t15-;/m1./s1

SMILES: C[C@H](c1cccc2ccccc12)NCc1cc2ccccc2[nH]1.Cl

Calindol hydrochloride

CAS: 729610-18-8

Calindol hydrochloride

Purity: ≥98%

Molecular weight: 336.86g/mol

Ref: 54-BUP12088

Calindol Hydrochloride

Controlled Product

CAS: 729610-18-8

Formula: C₂₁H₂₀N₂·ClH

Color and Shape: Neat

Molecular weight: 336.86

Ref: TR-C148700

Calindol hydrochloride

CAS: 729610-18-8

Calindol (hydrochloride) is a positive allosteric modulator (PAM) of calcimimetic calcium-sensing receptor (CaSR) with an EC50 of 132 nM.

Formula: C₂₁H₂₁ClN₂

Purity: 99.47%

Color and Shape: Solid

Molecular weight: 336.86

Ref: TM-T21758