CAS 729613-73-4
:5,6,7,8,9,10-Hexahydrocyclohepta[b]indole-4-carboxylic acid
Description:
5,6,7,8,9,10-Hexahydrocyclohepta[b]indole-4-carboxylic acid, with the CAS number 729613-73-4, is a bicyclic compound characterized by its complex polycyclic structure. This substance features a cycloheptane ring fused to an indole moiety, which contributes to its unique chemical properties. The presence of a carboxylic acid functional group at the 4-position enhances its reactivity and solubility in polar solvents. This compound is of interest in medicinal chemistry due to its potential biological activities, including effects on neurotransmitter systems. Its structural features may influence its interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stereochemistry and the arrangement of its functional groups can significantly affect its pharmacokinetic and pharmacodynamic profiles. Overall, 5,6,7,8,9,10-Hexahydrocyclohepta[b]indole-4-carboxylic acid represents a fascinating area of study within organic and medicinal chemistry, with implications for therapeutic applications.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c16-14(17)11-7-4-6-10-9-5-2-1-3-8-12(9)15-13(10)11/h4,6-7,15H,1-3,5,8H2,(H,16,17)
InChI key:InChIKey=YKASTBHMLNMFOL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C3=C(N2)CCCCC3)=CC=C1
Synonyms:- 5,6,7,8,9,10-Hexahydrocyclohepta[b]indole-4-carboxylic acid
- Cyclohept[b]indole-4-carboxylic acid, 5,6,7,8,9,10-hexahydro-
- 5,6,7,8,9,10-Hexahydrocyclohept[b]indole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.