CAS 72966-20-2
:2,4-dibenzyl-3-thioxo-1,2,4-thiadiazolidin-5-one
Description:
2,4-Dibenzyl-3-thioxo-1,2,4-thiadiazolidin-5-one is a heterocyclic compound characterized by the presence of a thiadiazolidinone ring, which incorporates sulfur and nitrogen atoms. This compound features two benzyl groups attached to the 2 and 4 positions of the thiadiazolidinone structure, contributing to its aromatic character and potentially influencing its solubility and reactivity. The thioxo group at the 3-position enhances its chemical reactivity, particularly in nucleophilic reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for various potential applications, including as a building block in organic synthesis or as a precursor for more complex molecules. The presence of sulfur and nitrogen in the ring system can also impart specific electronic properties, which may be relevant in the design of materials or catalysts. Overall, 2,4-dibenzyl-3-thioxo-1,2,4-thiadiazolidin-5-one is a compound of interest due to its structural features and potential applications in various fields of chemistry.
Formula:C16H14N2OS2
InChI:InChI=1/C16H14N2OS2/c19-16-17(11-13-7-3-1-4-8-13)15(20)18(21-16)12-14-9-5-2-6-10-14/h1-10H,11-12H2
SMILES:c1ccc(cc1)Cn1c(=S)n(Cc2ccccc2)sc1=O
Synonyms:- 1,2,4-Thiadiazolidin-5-One, 2,4-Bis(Phenylmethyl)-3-Thioxo-
- GSK-3InhibitorIII
- 2,4-Bis(phenylMethyl)-3-thioxo-1,2,4-thiadiazolidin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.