CAS 72985-22-9

2-(Hydroxymethyl)-5-methylbenzoic acid

Description:

2-(Hydroxymethyl)-5-methylbenzoic acid, with the CAS number 72985-22-9, is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a hydroxymethyl group and a methyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the methyl substituent can influence the compound's reactivity and steric properties. This substance may be utilized in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Its specific applications and behavior in reactions can vary based on the surrounding conditions and the presence of other functional groups. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₁₀O₃

InChI: InChI=1S/C9H10O3/c1-6-2-3-7(5-10)8(4-6)9(11)12/h2-4,10H,5H2,1H3,(H,11,12)

InChI key: InChIKey=CVFHJTNQTAYJBX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(CO)C=CC(C)=C1

Synonyms:

• Benzoic acid, 2-(hydroxymethyl)-5-methyl-
• 2-(Hydroxymethyl)-5-methylbenzoic acid