CAS 72985-50-3
:8-(Trifluoromethyl)-2H-3,1-benzoxazine-2,4(1H)-dione
Description:
8-(Trifluoromethyl)-2H-3,1-benzoxazine-2,4(1H)-dione, identified by its CAS number 72985-50-3, is a chemical compound characterized by its unique structure that includes a benzoxazine ring fused with a dione functional group. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The presence of the dione moiety suggests that it may exhibit tautomeric behavior and participate in various chemical reactions, such as nucleophilic attacks or cycloadditions. Its aromatic system contributes to stability and potential applications in materials science, particularly in the development of polymers or as intermediates in organic synthesis. Additionally, the trifluoromethyl group can enhance biological activity, making this compound of interest in medicinal chemistry. Overall, the combination of these functional groups provides a versatile platform for further chemical modifications and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H4F3NO3
InChI:InChI=1S/C9H4F3NO3/c10-9(11,12)5-3-1-2-4-6(5)13-8(15)16-7(4)14/h1-3H,(H,13,15)
InChI key:InChIKey=FWLOMSMDWVUGDL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(C(=O)OC(=O)N2)=CC=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Trifluoromethyl)isatoic anhydride
CAS:3-(Trifluoromethyl)isatoic anhydride
Formula:C9H4F3NO3Purity:techColor and Shape: lemon/gold crystalline powderMolecular weight:231.13g/mol
