CAS 7299-11-8

Psoromic acid

Description:

Psoromic acid, with the CAS number 7299-11-8, is a naturally occurring compound classified as a type of aromatic organic acid. It is primarily derived from various lichen species, particularly those in the genus *Usnea*. Psoromic acid is characterized by its phenolic structure, which contributes to its biological activity and potential medicinal properties. This compound exhibits antimicrobial and antifungal properties, making it of interest in pharmacological research. Additionally, psoromic acid has been studied for its role in traditional medicine and its potential applications in treating skin conditions. In terms of physical properties, psoromic acid is typically a solid at room temperature and may exhibit solubility in organic solvents. Its chemical behavior is influenced by the presence of hydroxyl groups, which can participate in hydrogen bonding and affect its reactivity. Overall, psoromic acid represents a significant compound in both natural product chemistry and potential therapeutic applications.

Formula: C₁₈H₁₄O₈

InChI: InChI=1S/C18H14O8/c1-7-4-11(20)10(6-19)15-13(7)18(23)26-14-8(2)12(24-3)5-9(17(21)22)16(14)25-15/h4-6,20H,1-3H3,(H,21,22)

InChI key: InChIKey=FUCWJKJZOHOLEO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=C(C)C(OC)=C1)OC(=O)C=3C(O2)=C(C=O)C(O)=CC3C

Synonyms:

• 11H-dibenzo[b,e][1,4]dioxepin-6-carboxylic acid, 4-formyl-3-hydroxy-8-methoxy-1,9-dimethyl-11-oxo-
• 4-Formyl-3-hydroxy-8-methoxy-1,9-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepin-6-carboxylic acid
• NSC 92186
• Parellic acid
• Psoromic acid

Psoromic acid

CAS: 7299-11-8

Psoromic acid: A rab-prenylation inhibitor with anti-TB, antibacterial, antioxidative, and cardio-protective properties. Promotes apoptosis.

Formula: C₁₈H₁₄O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 358.3

Ref: TM-TN4840