CAS 7299-33-4
:glycine-(15)N
Description:
Glycine-(15)N, with the CAS number 7299-33-4, is a stable isotope-labeled form of glycine, the simplest amino acid. It contains nitrogen-15, a non-radioactive isotope of nitrogen, which is often used in various biochemical and metabolic studies due to its unique nuclear properties. Glycine itself is a non-essential amino acid that plays a crucial role in protein synthesis and serves as a neurotransmitter in the central nervous system. The incorporation of the nitrogen-15 isotope allows researchers to trace metabolic pathways and study nitrogen metabolism in biological systems. Glycine-(15)N is typically used in isotopic labeling experiments, including NMR spectroscopy and mass spectrometry, to investigate protein dynamics, enzyme mechanisms, and metabolic fluxes. As a chemical substance, it is generally stable under standard laboratory conditions and is soluble in water, making it suitable for various experimental applications in biochemistry and molecular biology.
Formula:C2H515NO2
InChI:InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i3+1
Synonyms:- Glycine-15N
- (~15~N)glycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Glycine-15N
CAS:Controlled Product<p>Applications Glycine-15N is the labelled form of Glycine (G615990). Glycine is a non-essential amino acid for human development. Glycine is an inhibitory neurotransmitter in spinal cord, allosteric regulator of NMDA receptors.<br>References Scott, D., et al.: J. Neurosci., 21, 3063 (2001); Laube, B., et al.: Neuropharmacology, 47, 994 (2004); Papadakis, M., et al.: J. Biol. Chem., 279, 14703 (2004); Chen, P., et al.: Mol. Pharmacol., 67, 1470 (2005); Wolosker, H., et al.: Mol. Neurobiol., 36, 152 (2007)<br></p>Formula:C2H515NO2Color and Shape:White To Off-WhiteMolecular weight:76.060
