CymitQuimica logo

CAS 72990-57-9

:

N-(3-methylbutoxy)-1-(6-methylpyridin-2-yl)methanimine

Description:
N-(3-methylbutoxy)-1-(6-methylpyridin-2-yl)methanimine, with the CAS number 72990-57-9, is an organic compound characterized by its unique structure that includes a methanimine functional group and a pyridine ring. This compound features a 6-methylpyridine moiety, which contributes to its aromatic properties and potential biological activity. The presence of the 3-methylbutoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, depending on the balance of hydrophobic and hydrophilic groups within the molecule. Additionally, the presence of nitrogen in the methanimine group suggests potential for hydrogen bonding, which can affect its physical properties, such as boiling and melting points. While specific applications or biological activities may vary, compounds with similar structures are often explored in medicinal chemistry and material science for their potential therapeutic effects or as intermediates in chemical synthesis.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-10(2)7-8-15-13-9-12-6-4-5-11(3)14-12/h4-6,9-10H,7-8H2,1-3H3
SMILES:CC(C)CCON=Cc1cccc(C)n1
Synonyms:
  • 2-pyridinecarboxaldehyde, 6-methyl-, O-(3-methylbutyl)oxime
  • N-(3-Methylbutoxy)-1-(6-methylpyridin-2-yl)methanimine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.