CAS 730-73-4
:2-bromo-2-(4-chlorophenyl)-1H-indene-1,3(2H)-dione
Description:
2-Bromo-2-(4-chlorophenyl)-1H-indene-1,3(2H)-dione, with the CAS number 730-73-4, is an organic compound characterized by its unique structure, which includes an indene dione framework substituted with a bromine atom and a 4-chlorophenyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine and chlorine substituents can influence its reactivity and solubility, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The compound may exhibit biological activity, which is of interest in drug development. Its molecular structure allows for various chemical reactions, including electrophilic substitutions and nucleophilic additions, contributing to its versatility in synthetic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C15H8BrClO2
InChI:InChI=1/C15H8BrClO2/c16-15(9-5-7-10(17)8-6-9)13(18)11-3-1-2-4-12(11)14(15)19/h1-8H
SMILES:c1ccc2c(c1)C(=O)C(c1ccc(cc1)Cl)(C2=O)Br
Synonyms:- 1H-indene-1,3(2H)-dione, 2-bromo-2-(4-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.