CAS 7300-29-0
:2-Methyl-4-(phenylmethyl)pyridine
Description:
2-Methyl-4-(phenylmethyl)pyridine, with the CAS number 7300-29-0, is an organic compound that belongs to the class of pyridines, which are characterized by a six-membered aromatic ring containing one nitrogen atom. This particular compound features a methyl group and a phenylmethyl (benzyl) group attached to the pyridine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinct aromatic odor. The presence of the nitrogen atom in the pyridine ring imparts basicity to the compound, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Its structure suggests potential applications in organic synthesis and as a building block in pharmaceuticals or agrochemicals. Additionally, the compound's solubility in organic solvents and moderate stability under standard conditions make it suitable for various laboratory applications. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C13H13N
InChI:InChI=1S/C13H13N/c1-11-9-13(7-8-14-11)10-12-5-3-2-4-6-12/h2-9H,10H2,1H3
InChI key:InChIKey=FDFSVELZJFUAKL-UHFFFAOYSA-N
SMILES:C(C=1C=C(C)N=CC1)C2=CC=CC=C2
Synonyms:- 2-Methyl-4-(phenylmethyl)pyridine
- 230-744-3
- 4-Benzyl-2-Methylpyridine
- Pyridine, 2-methyl-4-(phenylmethyl)-
- 2-Picoline, 4-benzyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
