CAS 73006-78-7

5-chlorobiphenyl-2-amine

Description:

5-Chlorobiphenyl-2-amine, with the CAS number 73006-78-7, is an organic compound characterized by the presence of a biphenyl structure substituted with an amino group and a chlorine atom. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with a chlorine atom located at the 5-position of one ring and an amino group (-NH2) at the 2-position of the other ring. The presence of the chlorine atom introduces electronegative characteristics, influencing the compound's reactivity and solubility. 5-Chlorobiphenyl-2-amine is typically a solid at room temperature and may exhibit moderate stability under standard conditions. It is important in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, due to its structural features, it may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chlorinated organic compounds, due to potential toxicity and environmental concerns.

Formula: C₁₂H₁₀ClN

InChI: InChI=1/C12H10ClN/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8H,14H2

SMILES: c1ccc(cc1)c1cc(ccc1N)Cl

4-chloro-2-phenyl-aniline

CAS: 73006-78-7

Formula: C₁₂H₁₀ClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 203.6675

Ref: IN-DA005YRE

5-Chloro-[1,1'-biphenyl]-2-amine

CAS: 73006-78-7

5-Chloro-[1,1'-biphenyl]-2-amine

Purity: 99%

Molecular weight: 203.67g/mol

Ref: 54-OR76557

5-Chloro-[1,1′-biphenyl]-2-amine

CAS: 73006-78-7

Formula: C₁₂H₁₀ClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 203.67

Ref: 10-F519601

4-Chloro-2-phenylaniline

CAS: 73006-78-7

Versatile small molecule scaffold

Formula: C₁₂H₁₀ClN

Purity: Min. 95%

Molecular weight: 203.67 g/mol

Ref: 3D-YCA00678