CAS 7301-54-4
:Cortisol, glucuronide
Description:
Cortisol glucuronide, with the CAS number 7301-54-4, is a metabolite of cortisol, a steroid hormone produced by the adrenal cortex. This compound is formed through the process of glucuronidation, where a glucuronic acid moiety is conjugated to cortisol, enhancing its solubility and facilitating excretion from the body. Cortisol itself plays a crucial role in various physiological processes, including metabolism regulation, immune response modulation, and stress response. The glucuronide form is typically less biologically active than cortisol, serving primarily as a means for the body to eliminate excess cortisol. In terms of characteristics, cortisol glucuronide is generally a polar compound, which aids in its solubility in aqueous environments. It is often analyzed in biological samples to assess cortisol metabolism and can be indicative of various physiological and pathological states. Understanding its levels can provide insights into adrenal function and stress responses, making it relevant in clinical and research settings.
Formula:C27H38O11
InChI:InChI=1/C27H38O11/c1-25-7-5-14(29)9-13(25)3-4-15-16-6-8-27(37,26(16,2)10-17(30)20(15)25)19(32)12-38-24(36)23(35)22(34)21(33)18(31)11-28/h9,11,15-18,20-23,30-31,33-35,37H,3-8,10,12H2,1-2H3/t15-,16-,17+,18-,20+,21+,22-,23-,25-,26-,27-/m0/s1
InChI key:InChIKey=SXDBDFVHISOKJP-YXSMBZLISA-N
SMILES:C[C@@]12[C@]([C@]3([C@]([C@@H](O)C1)([C@]4(C)C(CC3)=CC(=O)CC4)[H])[H])(CC[C@@]2(C(CO[C@@H]5O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]5O)=O)O)[H]
Synonyms:- Pregn-4-ene-3,20-dione, 21-(β-D-glucopyranuronosyloxy)-11β,17-dihydroxy-
- Glucopyranosiduronic acid, 11β,17-dihydroxy-3,20-dioxopregn-4-en-21-yl, β-D-
- Cortisol, glucuronide
- Pregnane, β-D-glucopyranosiduronic acid deriv.
- β-D-Glucopyranosiduronic acid, (11β)-11,17-dihydroxy-3,20-dioxopregn-4-en-21-yl
- Cortisol 21-b-D-Glucuronide
- pregn-4-ene-3,20-dione
- Cortisol 21-beta-D-Glucuronide
- [2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2 ,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2 -oxo-ethyl] (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-hexanoate
- 21-(β-D-Glucopyranuronosyloxy)-11β,17-dihydroxy-
- 11β,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl β-D-Gluc
- hydrocortisone 21-glucuronate
- (11β)-11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl β-D-Glucopyranosiduronic Acid
- Cortisol 21-β-D-Glucuronide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
