CAS 73013-47-5
:ethyl 2-acetonylbenzoate
Description:
Ethyl 2-acetonylbenzoate, with the CAS number 73013-47-5, is an organic compound that belongs to the class of esters. It is characterized by its structure, which includes an ethyl group, a benzoate moiety, and an acetonyl functional group. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor. Ethyl 2-acetonylbenzoate is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. It is often utilized in the synthesis of various organic compounds and may serve as a flavoring agent or fragrance in certain applications. Additionally, it exhibits potential applications in the field of pharmaceuticals and agrochemicals. As with many organic compounds, safety precautions should be observed when handling ethyl 2-acetonylbenzoate, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-3-15-12(14)11-7-5-4-6-10(11)8-9(2)13/h4-7H,3,8H2,1-2H3
SMILES:CCOC(=O)c1ccccc1CC(=O)C
Synonyms:- 2-(2-Oxo-propyl)-benzoic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.