CAS 73013-49-7
:ethyl 3-acetonylbenzoate
Description:
Ethyl 3-acetonylbenzoate, with the CAS number 73013-49-7, is an organic compound that belongs to the class of esters. It is characterized by its structure, which includes an ethyl group, a benzoate moiety, and an acetonyl functional group. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor. Ethyl 3-acetonylbenzoate is known for its moderate solubility in organic solvents, while being less soluble in water, which is common for many esters. It exhibits properties such as stability under normal conditions, but may undergo hydrolysis in the presence of strong acids or bases. The compound is often utilized in the synthesis of various organic materials and may serve as a flavoring agent or fragrance component in the food and cosmetic industries. Additionally, it can be involved in chemical reactions such as esterification and condensation, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-3-15-12(14)11-6-4-5-10(8-11)7-9(2)13/h4-6,8H,3,7H2,1-2H3
SMILES:CCOC(=O)c1cccc(CC(=O)C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.