
CAS 73018-98-1
:3-Azido-1,2-propanediol
Description:
3-Azido-1,2-propanediol is an organic compound characterized by the presence of an azido group (-N3) attached to a propanediol backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the azido functional group, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of hydroxyl groups (-OH) in the propanediol structure also contributes to its potential for hydrogen bonding, influencing its solubility in polar solvents like water. 3-Azido-1,2-propanediol is of interest in synthetic organic chemistry and bioconjugation applications, particularly in the development of pharmaceuticals and biocompatible materials. However, due to the inherent instability of azides, safety precautions are necessary when handling this compound, as it can be sensitive to heat and shock, potentially leading to explosive decomposition.
Formula:C3H7N3O2
InChI:InChI=1S/C3H7N3O2/c4-6-5-1-3(8)2-7/h3,7-8H,1-2H2
InChI key:InChIKey=HTTNJQAFJLVWCN-UHFFFAOYSA-N
SMILES:C(CN=[N+]=[N-])(CO)O
Synonyms:- (±)-3-Azidopropane-1,2-diol
- 1,2-Propanediol, 3-azido-
- 3-Azido-1,2-propanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.