CAS 73018-99-2

1,2-Propanediol, 3-azido-, homopolymer

Description:

1,2-Propanediol, 3-azido-, homopolymer, with the CAS number 73018-99-2, is a synthetic polymer characterized by its azido functional groups, which are known for their reactivity and potential applications in various fields, including materials science and biochemistry. This polymer is derived from the polymerization of 1,2-propanediol with azide groups, resulting in a structure that can exhibit unique properties such as increased solubility and reactivity compared to non-functionalized polymers. The presence of azido groups allows for further chemical modifications, making it a versatile compound in the development of advanced materials, including those used in drug delivery systems and as precursors for other chemical syntheses. Additionally, the polymer's physical properties, such as molecular weight, thermal stability, and mechanical strength, can vary depending on the polymerization conditions and the degree of cross-linking. Safety considerations are important due to the potential hazards associated with azido compounds, which can be explosive under certain conditions. Overall, this polymer represents a significant area of interest in polymer chemistry and materials engineering.

Formula: (C₃H₇N₃O₂)x

InChI: InChI=1S/C3H7N3O2/c4-6-5-1-3(8)2-7/h3,7-8H,1-2H2

InChI key: InChIKey=HTTNJQAFJLVWCN-UHFFFAOYSA-N

SMILES: C(CN=[N+]=[N-])(CO)O

Synonyms:

• 1,2-Propanediol, 3-azido-, homopolymer