CymitQuimica logo

CAS 73037-90-8

:

3-[(4-chlorobenzyl)amino]propan-1-ol

Description:
3-[(4-Chlorobenzyl)amino]propan-1-ol, with the CAS number 73037-90-8, is an organic compound characterized by its amine and alcohol functional groups. It features a propanol backbone, where a 4-chlorobenzyl group is attached to the nitrogen atom of the amino group. This structure imparts both hydrophilic and lipophilic characteristics, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances the compound's reactivity and may influence its biological activity. Typically, compounds like this can exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and the ability to participate in hydrogen bonding due to the hydroxyl group. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and toxicity profile. Overall, 3-[(4-chlorobenzyl)amino]propan-1-ol represents a versatile structure in organic chemistry with potential implications in medicinal chemistry.
Formula:C10H14ClNO
InChI:InChI=1/C10H14ClNO/c11-10-4-2-9(3-5-10)8-12-6-1-7-13/h2-5,12-13H,1,6-8H2
SMILES:C(CNCc1ccc(cc1)Cl)CO
Synonyms:
  • 1-Propanol, 3-[[(4-Chlorophenyl)Methyl]Amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.