
CAS 73038-02-5
:8-(2-Propen-1-yl)quinoline
Description:
8-(2-Propen-1-yl)quinoline, identified by its CAS number 73038-02-5, is an organic compound characterized by a quinoline backbone substituted with a propenyl group at the 8-position. This compound typically exhibits a yellow to brown color and is known for its aromatic properties due to the presence of the quinoline structure, which consists of a fused benzene and pyridine ring. The propenyl group introduces unsaturation, which can influence its reactivity and potential applications in organic synthesis. 8-(2-Propen-1-yl)quinoline may exhibit biological activity, making it of interest in medicinal chemistry and research. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, including electrophilic substitutions and polymerization processes. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, this compound represents a unique structure that can serve as a building block in the synthesis of more complex molecules.
Formula:C12H11N
InChI:InChI=1S/C12H11N/c1-2-5-10-6-3-7-11-8-4-9-13-12(10)11/h2-4,6-9H,1,5H2
InChI key:InChIKey=RQSHIQHYEQBFJK-UHFFFAOYSA-N
SMILES:C(C=C)C=1C2=C(C=CC1)C=CC=N2
Synonyms:- Quinoline, 8-(2-propenyl)-
- 8-Allylquinoline
- Quinoline, 8-(2-propen-1-yl)-
- 8-(2-Propen-1-yl)quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.