CAS 7304-32-7
:2-fluoro-5-nitrobenzoic acid
Description:
2-Fluoro-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a fluoro and a nitro group on the benzene ring. Specifically, the fluoro group is located at the second position, while the nitro group is at the fifth position relative to the carboxylic acid functional group. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in polar solvents like water and alcohols. The presence of the electronegative fluorine and nitro groups contributes to its acidity and reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions in biological systems, which can be explored for medicinal chemistry purposes. Additionally, 2-fluoro-5-nitrobenzoic acid can undergo various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of its substituents. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H3FNO4
InChI:InChI=1/C7H4FNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1
SMILES:c1cc(c(cc1N(=O)=O)C(=O)[O-])F
Synonyms:- 2-Fluoro-5-nitro-benzoic acid
- 4-Chloro-3-(Trifluoromethyl)Pyridine Hydrochloride
- 2-Fluoro-5-Nitrobenzoate
- Buttpark 32\01-76
- Rarechem Al Bo 0445
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Fluoro-5-nitrobenzoic acid, 98%
CAS:2-Fluoro-5-nitrobenzoic acid may be used in the synthesis of dibenz[b,f]oxazepin-11(10H)-ones, via the nucleophilic aromatic substitution (SNAr) of fluorine in 2-fluoro-5-nitrobenzoic acid with the OH of various 2-aminophenols on solid support, synthesis of substituted dibenzazocines on solid suppoFormula:C7H4FNO4Purity:98%Color and Shape:Cream, Crystals or powder or crystalline powderMolecular weight:185.112-Fluoro-5-nitrobenzoic Acid
CAS:Formula:C7H4FNO4Purity:97%Color and Shape:SolidMolecular weight:185.10942-Fluoro-5-nitrobenzoic acid
CAS:2-Fluoro-5-nitrobenzoic acid
Formula:C7H4FNO4Purity:98%Color and Shape: off white crystalline powderMolecular weight:185.11g/mol2-Fluoro-5-nitrobenzoic Acid
CAS:Formula:C7H4FNO4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:185.112-Fluoro-5-nitrobenzoic acid
CAS:2-Fluoro-5-nitrobenzoic acid is a molecule that can be used in biological studies to measure the proton concentration of a solution. This compound has been shown to bind to caffeine and β-amino acids, which may be due to its ability to form intermolecular hydrogen bonds. 2-Fluoro-5-nitrobenzoic acid has also been shown to enhance reactive oxygen species generation by nitrobenzoic molecules, making it a potential drug for the treatment of cancer.Formula:C7H4FNO4Purity:Min. 95%Color and Shape:PowderMolecular weight:185.11 g/mol2-Fluoro-5-nitrobenzoic acid
CAS:Formula:C7H4FNO4Purity:97%Color and Shape:SolidMolecular weight:185.112-Fluoro-5-nitrobenzoic Acid
CAS:Controlled ProductApplications 2-Fluoro-5-nitrobenzoic Acid (cas# 7304-32-7) is a compound useful in organic synthesis.
Formula:C7H4FNO4Color and Shape:NeatMolecular weight:185.112-Fluoro-5-nitrobenzoic acid
CAS:Formula:C7H4FNO4Purity:99.0 min. %Color and Shape:White to off-white solidMolecular weight:185.11








