CAS 7304-48-5
:Fluorotris(2-methylpropyl)stannane
Description:
Fluorotris(2-methylpropyl)stannane, with the CAS number 7304-48-5, is an organotin compound characterized by the presence of a tin atom bonded to three 2-methylpropyl groups and one fluorine atom. This compound typically exhibits a tetrahedral geometry around the tin center, which is common for organotin compounds. The presence of the fluorine atom introduces unique reactivity and properties, potentially enhancing its stability and solubility in organic solvents. Organotin compounds are known for their applications in various fields, including as stabilizers in PVC production, biocides, and catalysts in organic synthesis. However, they can also pose environmental and health risks due to their toxicity and bioaccumulation potential. The 2-methylpropyl groups contribute to the hydrophobic nature of the molecule, influencing its interactions in biological and chemical systems. Overall, Fluorotris(2-methylpropyl)stannane is a specialized compound with specific applications, but its use must be carefully managed due to the associated risks of organotin chemistry.
Formula:C12H27FSn
InChI:InChI=1/3C4H9.FH.Sn/c3*1-4(2)3;;/h3*4H,1H2,2-3H3;1H;/q;;;;+1/p-1/rC12H27FSn/c1-10(2)7-14(13,8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3
InChI key:InChIKey=OUURAJKTQFMUFK-UHFFFAOYSA-M
SMILES:[Sn](CC(C)C)(CC(C)C)(CC(C)C)F
Synonyms:- Fluoro[Tris(2-Methylpropyl)]Stannane
- Fluorotris(2-methylpropyl)stannane
- Stannane, fluorotriisobutyl-
- Stannane, fluorotris(2-methylpropyl)-
- Triisobutyl tin fluoride
- Triisobutyltin fluoride
- Fluorotriisobutylstannane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.