CymitQuimica logo

CAS 73040-03-6

:

Ethyl 6-methyl-1-oxaspiro[2.5]octane-2-carboxylate

Description:
Ethyl 6-methyl-1-oxaspiro[2.5]octane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring an ether linkage and a carboxylate functional group. This compound typically exhibits moderate polarity due to the presence of the ester and ether functionalities, which can influence its solubility in various organic solvents. The spiro structure contributes to its rigidity, potentially affecting its reactivity and interaction with biological systems. Ethyl 6-methyl-1-oxaspiro[2.5]octane-2-carboxylate may be of interest in synthetic organic chemistry and medicinal chemistry due to its potential applications in drug development or as a building block for more complex molecules. Its CAS number, 73040-03-6, allows for easy identification in chemical databases. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C11H18O3
InChI:InChI=1S/C11H18O3/c1-3-13-10(12)9-11(14-9)6-4-8(2)5-7-11/h8-9H,3-7H2,1-2H3
InChI key:InChIKey=KAJXXKIXJKJMEG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1C2(O1)CCC(C)CC2
Synonyms:
  • Ethyl 6-methyl-1-oxaspiro[2.5]octane-2-carboxylate
  • 1-Oxaspiro[2.5]octane-2-carboxylic acid, 6-methyl-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.