CAS 73041-54-0

2-(5-chloro-2-methylbenzoyl)benzoic acid

Description:

2-(5-Chloro-2-methylbenzoyl)benzoic acid, with the CAS number 73041-54-0, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of a chloro substituent and a methyl group on the aromatic ring influences its reactivity and solubility properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic aromatic structure. Its chemical properties may include the ability to participate in electrophilic aromatic substitution reactions, and it may also act as a ligand in coordination chemistry. Additionally, the compound's chlorinated and methylated substituents can affect its biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₅H₁₁ClO₃

InChI: InChI=1/C15H11ClO3/c1-9-6-7-10(16)8-13(9)14(17)11-4-2-3-5-12(11)15(18)19/h2-8H,1H3,(H,18,19)

SMILES: Cc1ccc(cc1C(=O)c1ccccc1C(=O)O)Cl