CymitQuimica logo

CAS 73051-44-2

:

2,2-Difluoro-5-amino-6-chloro-1,3-benzodioxole

Description:
2,2-Difluoro-5-amino-6-chloro-1,3-benzodioxole is an organic compound characterized by its unique structure, which includes a benzodioxole core substituted with fluorine, chlorine, and amino groups. The presence of two fluorine atoms at the 2-position enhances its lipophilicity and may influence its reactivity and biological activity. The amino group at the 5-position can participate in hydrogen bonding and may serve as a site for further chemical modifications. The chlorine atom at the 6-position adds to the compound's electrophilic character, potentially making it reactive in various chemical reactions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its specific functional groups suggest potential applications in agrochemicals or as intermediates in organic synthesis. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C7H4ClF2NO2
InChI:InChI=1S/C7H4ClF2NO2/c8-3-1-5-6(2-4(3)11)13-7(9,10)12-5/h1-2H,11H2
InChI key:DJBHURPHBJCVAN-UHFFFAOYSA-N
SMILES:C1=C(C(=CC2=C1OC(O2)(F)F)Cl)N
Found 4 products.