CAS 7306-17-4
:2-(1-phenylcyclobutyl)acetic acid
Description:
2-(1-Phenylcyclobutyl)acetic acid, with the CAS number 7306-17-4, is an organic compound characterized by its unique bicyclic structure that includes a cyclobutane ring fused to a phenyl group. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The presence of the phenyl group enhances its hydrophobic characteristics, while the cyclobutyl moiety can influence its steric and electronic properties. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can affect its solubility and stability in different environments. Additionally, the compound's synthesis and characterization may involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its identity and purity. Overall, 2-(1-phenylcyclobutyl)acetic acid represents a fascinating example of how structural features can influence the chemical behavior and potential applications of organic molecules.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c13-11(14)9-12(7-4-8-12)10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,13,14)
SMILES:c1ccc(cc1)C1(CCC1)CC(=O)O
Synonyms:- (1-Phenylcyclobutyl)acetic acid
- Cyclobutaneacetic Acid, 1-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.