CAS 73069-27-9
:[(9S,10S)-10-acetoxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate
Description:
The chemical substance with the name "[(9S,10S)-10-acetoxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] (Z)-2-methylbut-2-enoate" and CAS number 73069-27-9 is a complex organic compound characterized by its unique structural features. It contains a chromene core, which is a bicyclic structure that includes a benzene ring fused to a pyran ring. The presence of an acetoxy group indicates that it has an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The (Z)-2-methylbut-2-enoate moiety suggests that the compound has a double bond configuration that can influence its stereochemistry and biological activity. This compound may exhibit various properties such as solubility in organic solvents, potential biological activity, and reactivity due to the presence of functional groups. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its biological properties and reactivity. Further studies would be necessary to elucidate its full range of characteristics and potential uses.
Formula:C21H22O7
InChI:InChI=1/C21H22O7/c1-6-11(2)20(24)27-19-18(25-12(3)22)16-14(28-21(19,4)5)9-7-13-8-10-15(23)26-17(13)16/h6-10,18-19H,1-5H3/b11-6-/t18-,19-/m0/s1
SMILES:C/C=C(/C)\C(=O)O[C@H]1[C@H](c2c(ccc3ccc(=O)oc23)OC1(C)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Butenoic acid, 2-methyl-,(9S,10S)-10-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester, (2Z)-
CAS:Formula:C21H22O7Purity:98%Color and Shape:SolidMolecular weight:386.3952Praeruptorin A
CAS:(+)-Praeruptorin A exerts distinct relaxant effects on isolated rat aorta rings, which may be mainly attributed to nitric oxide synthesis catalyzed by endothelial nitric oxide synthase.Formula:C21H22O7Purity:95%~99%Molecular weight:386.4Praeruptorin A
CAS:Praeruptorin A ((+)-Praeruptorin A) has the potential to inhibit migration/fusion of preosteoclasts in vitro and bone erosion in vivo by targeting calmodulinFormula:C21H22O7Purity:99.63% - 99.65%Color and Shape:SolidMolecular weight:386.4(+)-praeruptorin a
CAS:LactoneFormula:C21H22O7Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:386.4





