CymitQuimica logo

CAS 7307-08-6

:

Diisovalerylmethane

Description:
Diisovalerylmethane, with the CAS number 7307-08-6, is an organic compound characterized by its structure, which features two isovaleryl groups attached to a central methane unit. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. Diisovalerylmethane is primarily utilized in organic synthesis and as an intermediate in the production of other chemical compounds. Its chemical properties include stability under standard conditions, but it may undergo reactions typical of ketones, such as nucleophilic addition. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, diisovalerylmethane is an interesting compound within the realm of organic chemistry, with potential applications in both industrial and research settings.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-8(2)5-10(12)7-11(13)6-9(3)4/h8-9H,5-7H2,1-4H3
InChI key:GJMUCDMIIVSROW-UHFFFAOYSA-N
SMILES:CC(C)CC(=O)CC(=O)CC(C)C
Found 4 products.