CymitQuimica logo

CAS 73083-51-9

:

5,5,7,7-tetramethyl-4-oxo-3-phenyl-4,4a,5,7-tetrahydrofuro[3,4-e][1,2,4]triazin-4-ium

Description:
5,5,7,7-tetramethyl-4-oxo-3-phenyl-4,4a,5,7-tetrahydrofuro[3,4-e][1,2,4]triazin-4-ium is a complex organic compound characterized by its unique triazine ring structure, which incorporates both furan and phenyl groups. This compound features a tetrahydrofuro moiety, contributing to its cyclic structure and potential reactivity. The presence of multiple methyl groups enhances its hydrophobic characteristics and may influence its solubility in organic solvents. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The triazine core is known for its stability and potential applications in fields like agrochemicals and pharmaceuticals. Additionally, the compound's ionic nature, suggested by the "ium" suffix, implies that it may exist as a zwitterion or cation in certain conditions, affecting its interaction with other molecules. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in synthetic and applied chemistry.
Formula:C15H18N3O2
InChI:InChI=1/C15H18N3O2/c1-14(2)11-12(15(3,4)20-14)18(19)13(17-16-11)10-8-6-5-7-9-10/h5-9,12H,1-4H3/q+1
SMILES:CC1(C)C2=NN=C(c3ccccc3)N(C2C(C)(C)O1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.