
CAS 73084-05-6
:N-1,3,4-Thiadiazol-2-yl-2-thiophenecarboxamide
Description:
N-1,3,4-Thiadiazol-2-yl-2-thiophenecarboxamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a thiophene moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the thiadiazole and thiophene rings suggests that it may possess interesting electronic properties, making it a candidate for applications in pharmaceuticals or agrochemicals. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and stability. Additionally, compounds of this nature are often investigated for their antimicrobial, antifungal, or herbicidal properties, reflecting their potential utility in various fields. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for toxicity or environmental impact. Overall, N-1,3,4-Thiadiazol-2-yl-2-thiophenecarboxamide represents a class of compounds with diverse applications and significant research interest.
Formula:C7H5N3OS2
InChI:InChI=1S/C7H5N3OS2/c11-6(5-2-1-3-12-5)9-7-10-8-4-13-7/h1-4H,(H,9,10,11)
InChI key:InChIKey=QWIIHSJKZGHOLX-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CS1)C2=NN=CS2
Synonyms:- N-1,3,4-Thiadiazol-2-yl-2-thiophenecarboxamide
- 2-Thiophenecarboxamide, N-1,3,4-thiadiazol-2-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.