CAS 7309-52-6
:2-(3-methoxyphenoxy)propanoic acid
Description:
2-(3-Methoxyphenoxy)propanoic acid, with the CAS number 7309-52-6, is an organic compound characterized by its aromatic structure and functional groups. It features a propanoic acid moiety, which contributes to its acidity, and a methoxy-substituted phenoxy group that enhances its hydrophobic properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the presence of the hydrophobic phenyl ring. The methoxy group (-OCH3) provides additional steric hindrance and can influence the compound's reactivity and interaction with biological systems. 2-(3-Methoxyphenoxy)propanoic acid is often studied for its potential applications in pharmaceuticals and agrochemicals, particularly in the context of plant growth regulation or as a herbicide. Its chemical stability and reactivity can be influenced by environmental factors, making it a subject of interest in both synthetic and applied chemistry.
Formula:C10H12O4
InChI:InChI=1/C10H12O4/c1-7(10(11)12)14-9-5-3-4-8(6-9)13-2/h3-7H,1-2H3,(H,11,12)
SMILES:CC(C(=O)O)Oc1cccc(c1)OC
Synonyms:- Propanoic Acid, 2-(3-Methoxyphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(3-Methoxy-phenoxy)-propionic acid
CAS:Formula:C10H12O4Purity:97%Color and Shape:SolidMolecular weight:196.19992-(3-Methoxyphenoxy)propanoic acid
CAS:2-(3-Methoxyphenoxy)propanoic acidPurity:97%Molecular weight:196.20g/mol2-(3-Methoxyphenoxy)propanoic acid
CAS:Controlled ProductApplications 2-(3-Methoxyphenoxy)propanoic acid
Formula:C10H12O4Color and Shape:NeatMolecular weight:196.22-(3-Methoxy-phenoxy)-propionic acid
CAS:2-(3-Methoxy-phenoxy)-propionic acid is a chiral compound that is used in organic synthesis. The racemic form of this molecule can be crystallized with the help of other molecules such as cocrystallization, heterodimers, underscores and enantiomers. It crystallizes in two different forms: the α-form and the β-form. The α-form has a melting point of 120 °C, whereas the β-form melts at 138 °C. The polymorphic nature of 2-(3-methoxy-phenoxy)-propionic acid is due to its structural differences in the crystal lattice. These differences are made possible by supramolecular interactions between neighboring molecules.
Formula:C10H12O4Purity:Min. 95%Molecular weight:196.2 g/mol




