CymitQuimica logo

CAS 730949-60-7

:

2-[[4,5-Dihydro-4-[(4-methoxyphenyl)methylene]-5-oxo-1-(phenylmethyl)-1H-imidazol-2-yl]thio]acetic acid

Description:
2-[[4,5-Dihydro-4-[(4-methoxyphenyl)methylene]-5-oxo-1-(phenylmethyl)-1H-imidazol-2-yl]thio]acetic acid, with CAS number 730949-60-7, is a synthetic organic compound characterized by its complex structure, which includes an imidazole ring, a thioacetic acid moiety, and a methoxyphenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the imidazole ring suggests possible interactions with biological targets, potentially influencing enzyme activity or receptor binding. Additionally, the methoxy group may enhance lipophilicity, affecting the compound's pharmacokinetics. Its thioacetic acid component may contribute to its reactivity and biological properties. Overall, this compound's unique structural features may lead to diverse applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values.
Formula:C20H18N2O4S
InChI:InChI=1S/C20H18N2O4S/c1-26-16-9-7-14(8-10-16)11-17-19(25)22(12-15-5-3-2-4-6-15)20(21-17)27-13-18(23)24/h2-11H,12-13H2,1H3,(H,23,24)
InChI key:InChIKey=IKPIHMNXILVOAO-UHFFFAOYSA-N
SMILES:C(N1C(SCC(O)=O)=NC(=CC2=CC=C(OC)C=C2)C1=O)C3=CC=CC=C3
Synonyms:
  • Acetic acid, 2-[[4,5-dihydro-4-[(4-methoxyphenyl)methylene]-5-oxo-1-(phenylmethyl)-1H-imidazol-2-yl]thio]-
  • 2-[[4,5-Dihydro-4-[(4-methoxyphenyl)methylene]-5-oxo-1-(phenylmethyl)-1H-imidazol-2-yl]thio]acetic acid
  • Acetic acid, [[4,5-dihydro-4-[(4-methoxyphenyl)methylene]-5-oxo-1-(phenylmethyl)-1H-imidazol-2-yl]thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.