CAS 730949-69-6

N-1,3-Benzodioxol-5-yl-2-[(2-chloroacetyl)amino]benzamide

Description:

N-1,3-Benzodioxol-5-yl-2-[(2-chloroacetyl)amino]benzamide, identified by its CAS number 730949-69-6, is a synthetic organic compound characterized by its complex structure that includes a benzodioxole moiety and an amide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may contribute to its potential biological activity. The presence of the chloroacetyl group suggests reactivity that could be exploited in various chemical reactions, including nucleophilic substitutions. The benzodioxole structure is often associated with pharmacological properties, making this compound of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are crucial for its application in research or therapeutic contexts. As with many synthetic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can pose health risks. Overall, this compound represents a unique intersection of structural features that may lend itself to diverse applications in chemical and pharmaceutical research.

Formula: C₁₆H₁₃ClN₂O₄

InChI: InChI=1S/C16H13ClN2O4/c17-8-15(20)19-12-4-2-1-3-11(12)16(21)18-10-5-6-13-14(7-10)23-9-22-13/h1-7H,8-9H2,(H,18,21)(H,19,20)

InChI key: InChIKey=NYZGTUCQLQLOTI-UHFFFAOYSA-N

SMILES: C(NC=1C=C2C(=CC1)OCO2)(=O)C3=C(NC(CCl)=O)C=CC=C3

Synonyms:

• Benzamide, N-1,3-benzodioxol-5-yl-2-[(chloroacetyl)amino]-
• Benzamide, N-1,3-benzodioxol-5-yl-2-[(2-chloroacetyl)amino]-
• N-1,3-Benzodioxol-5-yl-2-[(2-chloroacetyl)amino]benzamide

N-(1,3-Dioxaindan-5-yl)-2-(2-chloroacetamido)benzamide

CAS: 730949-69-6

Versatile small molecule scaffold

Formula: C₁₆H₁₃ClN₂O₄

Purity: Min. 95%

Molecular weight: 332.74 g/mol

Ref: 3D-FEB94969