CAS 730949-73-2

2-Cyano-3-[2,5-dimethyl-1-(2-methylpropyl)-1H-pyrrol-3-yl]-2-propenoic acid

Description:

2-Cyano-3-[2,5-dimethyl-1-(2-methylpropyl)-1H-pyrrol-3-yl]-2-propenoic acid, identified by its CAS number 730949-73-2, is an organic compound characterized by its complex structure, which includes a cyano group, a propenoic acid moiety, and a pyrrole ring. This compound features a pyrrole ring substituted with two methyl groups and a branched alkyl group, contributing to its unique chemical properties. The presence of the cyano group indicates potential reactivity, particularly in nucleophilic addition reactions. The propenoic acid component suggests that it may participate in polymerization reactions or serve as a building block in organic synthesis. Additionally, the compound's structural features may influence its solubility, stability, and biological activity, making it of interest in various fields, including medicinal chemistry and materials science. Overall, the specific characteristics of this compound, such as its melting point, boiling point, and reactivity, would require empirical data for precise evaluation.

Formula: C₁₄H₁₈N₂O₂

InChI: InChI=1S/C14H18N2O2/c1-9(2)8-16-10(3)5-12(11(16)4)6-13(7-15)14(17)18/h5-6,9H,8H2,1-4H3,(H,17,18)

InChI key: InChIKey=SWGSYVJVZSGZPQ-UHFFFAOYSA-N

SMILES: C(=C(C(O)=O)C#N)C1=C(C)N(CC(C)C)C(C)=C1

Synonyms:

• 2-Propenoic acid, 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)-1H-pyrrol-3-yl]-
• 2-Cyano-3-[2,5-dimethyl-1-(2-methylpropyl)-1H-pyrrol-3-yl]-2-propenoic acid

2-Cyano-3-[2,5-dimethyl-1-(2-methylpropyl)-1H-pyrrol-3-yl]prop-2-enoic acid

CAS: 730949-73-2

Versatile small molecule scaffold

Formula: C₁₄H₁₈N₂O₂

Purity: Min. 95%

Molecular weight: 246.3 g/mol

Ref: 3D-FEB94973