CymitQuimica logo

CAS 730949-86-7

:

2-Methoxyethyl 5-(aminocarbonyl)-2-[(2-chloroacetyl)amino]-4-methyl-3-thiophenecarboxylate

Description:
2-Methoxyethyl 5-(aminocarbonyl)-2-[(2-chloroacetyl)amino]-4-methyl-3-thiophenecarboxylate is a chemical compound characterized by its complex structure, which includes a thiophene ring, an aminocarbonyl group, and a methoxyethyl substituent. This compound is typically classified as an ester due to the presence of the carboxylate functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. The chloroacetyl moiety may enhance its reactivity, making it a candidate for further derivatization. Additionally, the methoxyethyl group can influence its solubility and bioavailability. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other substances. Safety data and handling precautions should be considered, as the presence of chlorine and amine groups may pose certain hazards. Overall, this compound represents a unique structure with potential utility in chemical synthesis and drug development.
Formula:C12H15ClN2O5S
InChI:InChI=1S/C12H15ClN2O5S/c1-6-8(12(18)20-4-3-19-2)11(15-7(16)5-13)21-9(6)10(14)17/h3-5H2,1-2H3,(H2,14,17)(H,15,16)
InChI key:InChIKey=YZWPVMPFVKZUJB-UHFFFAOYSA-N
SMILES:C(OCCOC)(=O)C1=C(NC(CCl)=O)SC(C(N)=O)=C1C
Synonyms:
  • 2-Methoxyethyl 5-(aminocarbonyl)-2-[(2-chloroacetyl)amino]-4-methyl-3-thiophenecarboxylate
  • 3-Thiophenecarboxylic acid, 5-(aminocarbonyl)-2-[(chloroacetyl)amino]-4-methyl-, 2-methoxyethyl ester
  • 3-Thiophenecarboxylic acid, 5-(aminocarbonyl)-2-[(2-chloroacetyl)amino]-4-methyl-, 2-methoxyethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.