CymitQuimica logo

CAS 730949-91-4

:

N-(6-Amino-1-butyl-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl)-N-butyl-2-chloroacetamide

Description:
N-(6-Amino-1-butyl-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl)-N-butyl-2-chloroacetamide, with the CAS number 730949-91-4, is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring and multiple functional groups. This compound features a butyl chain and a chloroacetamide moiety, contributing to its potential biological activity. The presence of an amino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions. Its tetrahydro-2,4-dioxo structure indicates that it may exhibit unique properties related to its reactivity and stability. The compound's potential applications could span medicinal chemistry, particularly in drug development, due to its structural features that may interact with biological targets. However, specific information regarding its solubility, melting point, and other physical properties would require empirical data. As with many synthetic compounds, safety and handling precautions should be observed, given the presence of chlorine and other reactive groups.
Formula:C14H23ClN4O3
InChI:InChI=1S/C14H23ClN4O3/c1-3-5-7-18(10(20)9-15)11-12(16)19(8-6-4-2)14(22)17-13(11)21/h3-9,16H2,1-2H3,(H,17,21,22)
InChI key:InChIKey=SKNUWCJPKWKNGJ-UHFFFAOYSA-N
SMILES:N(CCCC)(C(CCl)=O)C1=C(N)N(CCCC)C(=O)NC1=O
Synonyms:
  • Acetamide, N-(6-amino-1-butyl-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl)-N-butyl-2-chloro-
  • N-(6-Amino-1-butyl-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinyl)-N-butyl-2-chloroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.