
CAS 730949-96-9
:2-Chloro-N-[4-chloro-3-[[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]sulfonyl]phenyl]propanamide
Description:
2-Chloro-N-[4-chloro-3-[[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]sulfonyl]phenyl]propanamide, with the CAS number 730949-96-9, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, sulfonamides, and chloro substituents. This compound features a pyrazole ring, contributing to its potential biological activity, particularly in medicinal chemistry. The presence of the sulfonyl group enhances its solubility and reactivity, making it a candidate for various pharmaceutical applications. Its chlorinated phenyl groups may influence its interaction with biological targets, potentially affecting its pharmacokinetics and pharmacodynamics. The compound's structural complexity suggests it may exhibit unique properties, including specific binding affinities or inhibitory effects in biological systems. As with many synthetic compounds, its safety, efficacy, and environmental impact would need to be thoroughly evaluated through rigorous testing and research.
Formula:C20H20Cl2N4O4S
InChI:InChI=1S/C20H20Cl2N4O4S/c1-12(21)19(27)23-14-9-10-16(22)17(11-14)31(29,30)24-18-13(2)25(3)26(20(18)28)15-7-5-4-6-8-15/h4-12,24H,1-3H3,(H,23,27)
InChI key:InChIKey=AKPHBURSSRGMJS-UHFFFAOYSA-N
SMILES:O=C1N(N(C)C(C)=C1NS(=O)(=O)C2=CC(NC(C(C)Cl)=O)=CC=C2Cl)C3=CC=CC=C3
Synonyms:- Propanamide, 2-chloro-N-[4-chloro-3-[[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]sulfonyl]phenyl]-
- 2-Chloro-N-[4-chloro-3-[[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]sulfonyl]phenyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.