
CAS 730950-04-6
:6-Bromo-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxin
Description:
6-Bromo-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxin is a synthetic organic compound characterized by its complex structure, which includes a benzodioxin core substituted with bromine and chloromethyl groups. This compound typically exhibits properties associated with halogenated aromatic compounds, such as potential reactivity due to the presence of the bromine and chloromethyl substituents. It may display moderate to high lipophilicity, influencing its solubility in organic solvents and its behavior in biological systems. The presence of the phenyl group can enhance its stability and may contribute to its electronic properties, potentially affecting its reactivity and interaction with other chemical species. Additionally, compounds of this nature may be of interest in medicinal chemistry and materials science due to their potential biological activity and utility in the development of novel pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C15H12BrClO2
InChI:InChI=1S/C15H12BrClO2/c16-13-6-11(8-17)14-12(7-13)9-18-15(19-14)10-4-2-1-3-5-10/h1-7,15H,8-9H2
InChI key:InChIKey=TULUXDVSSAUPNQ-UHFFFAOYSA-N
SMILES:C(Cl)C1=C2C(COC(O2)C3=CC=CC=C3)=CC(Br)=C1
Synonyms:- 6-Bromo-8-(chloromethyl)-2-phenyl-4H-1,3-benzodioxin
- 4H-1,3-Benzodioxin, 6-bromo-8-(chloromethyl)-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.