CymitQuimica logo

CAS 730950-07-9

:

2-Chloro-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl)acetamide

Description:
2-Chloro-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl)acetamide is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a chloro group and an acetamide functional group. This compound features a diazaspiro framework, indicating the presence of nitrogen atoms within a spiro-connected ring system, contributing to its potential biological activity. The presence of the 2,4-dioxo moiety suggests that it may exhibit reactivity typical of diketones, potentially participating in various chemical reactions. The chloro substituent can influence the compound's solubility and reactivity, making it a candidate for further study in medicinal chemistry. Its structural complexity may also impart specific pharmacological properties, making it of interest in drug development. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Overall, this compound's unique structural features may offer insights into its potential applications in pharmaceuticals or agrochemicals.
Formula:C11H16ClN3O3
InChI:InChI=1S/C11H16ClN3O3/c1-7-2-4-11(5-3-7)9(17)15(10(18)13-11)14-8(16)6-12/h7H,2-6H2,1H3,(H,13,18)(H,14,16)
InChI key:InChIKey=WBYRTEWWUGFVLP-UHFFFAOYSA-N
SMILES:O=C1C2(NC(=O)N1NC(CCl)=O)CCC(C)CC2
Synonyms:
  • 2-Chloro-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl)acetamide
  • Acetamide, 2-chloro-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.