CAS 730950-22-8

Ethyl 2-amino-4-(bromomethyl)-5-[(dimethylamino)carbonyl]-3-thiophenecarboxylate

Description:

Ethyl 2-amino-4-(bromomethyl)-5-[(dimethylamino)carbonyl]-3-thiophenecarboxylate is a chemical compound characterized by its complex structure, which includes a thiophene ring, an ethyl ester group, and various functional groups such as an amino group and a bromomethyl substituent. The presence of the thiophene moiety contributes to its potential applications in organic synthesis and medicinal chemistry, as thiophenes are known for their diverse biological activities. The dimethylamino group enhances the compound's basicity and may influence its solubility and reactivity. The bromomethyl group can serve as a reactive site for further chemical modifications, making it a versatile intermediate in synthetic pathways. This compound is typically handled with care due to the presence of bromine, which can pose health and environmental risks. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions under which it is studied. Overall, this compound exemplifies the complexity and utility of heterocyclic compounds in chemical research and development.

Formula: C₁₁H₁₅BrN₂O₃S

InChI: InChI=1S/C11H15BrN2O3S/c1-4-17-11(16)7-6(5-12)8(18-9(7)13)10(15)14(2)3/h4-5,13H2,1-3H3

InChI key: InChIKey=IKDVFIWRFMOVDX-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(CBr)=C(C(N(C)C)=O)SC1N

Synonyms:

• Ethyl 2-amino-4-(bromomethyl)-5-[(dimethylamino)carbonyl]-3-thiophenecarboxylate
• 3-Thiophenecarboxylic acid, 2-amino-4-(bromomethyl)-5-[(dimethylamino)carbonyl]-, ethyl ester