CymitQuimica logo

CAS 730951-47-0

:

5-(2-Hydroxybenzoyl)-2-oxo[1(2H),2′-bipyridine]-3-carbonitrile

Description:
5-(2-Hydroxybenzoyl)-2-oxo[1(2H),2′-bipyridine]-3-carbonitrile is a chemical compound characterized by its complex structure, which includes a bipyridine moiety and functional groups such as a hydroxyl group and a carbonitrile group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group suggests the potential for hydrogen bonding, which can influence solubility and reactivity. Additionally, the carbonitrile group may impart unique electronic properties, making it useful in coordination chemistry or as a ligand in metal complexes. The compound's structural features may also allow for specific interactions with biological targets, indicating potential for bioactivity. Overall, the characteristics of this compound make it a subject of interest for further research in synthetic chemistry and its applications in drug development or as a functional material.
Formula:C18H11N3O3
InChI:InChI=1S/C18H11N3O3/c19-10-12-9-13(17(23)14-5-1-2-6-15(14)22)11-21(18(12)24)16-7-3-4-8-20-16/h1-9,11,22H
InChI key:InChIKey=ARHPZWOJFGHEFU-UHFFFAOYSA-N
SMILES:O=C1N(C=C(C(=O)C2=C(O)C=CC=C2)C=C1C#N)C3=CC=CC=N3
Synonyms:
  • [1(2H),2′-Bipyridine]-3-carbonitrile, 5-(2-hydroxybenzoyl)-2-oxo-
  • 5-(2-Hydroxybenzoyl)-2-oxo[1(2H),2′-bipyridine]-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.