CAS 73096-27-2

(2R)-1-[(4-chlorophenyl)sulfonyl]pyrrolidine-2-carboxylate

Description:

The chemical substance known as (2R)-1-[(4-chlorophenyl)sulfonyl]pyrrolidine-2-carboxylate, with the CAS number 73096-27-2, is characterized by its structural features that include a pyrrolidine ring, a carboxylate group, and a sulfonyl group attached to a chlorophenyl moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylate group. The sulfonyl group enhances its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The presence of the 4-chlorophenyl group may influence its biological activity, potentially imparting pharmacological properties. Additionally, the chirality at the pyrrolidine ring suggests that the compound may exhibit stereoselective behavior in biological systems, which is crucial for its interaction with biological targets. Overall, this compound's unique structural characteristics contribute to its potential applications in medicinal chemistry and drug development.

Formula: C₁₁H₁₁ClNO₄S

InChI: InChI=1/C11H12ClNO4S/c12-8-3-5-9(6-4-8)18(16,17)13-7-1-2-10(13)11(14)15/h3-6,10H,1-2,7H2,(H,14,15)/p-1/t10-/m1/s1

SMILES: C1C[C@H](C(=O)[O-])N(C1)S(=O)(=O)c1ccc(cc1)Cl

1-[(4-Chlorophenyl)sulfonyl]-2-pyrrolidinecarboxylic acid

CAS: 73096-27-2

Formula: C₁₁H₁₂ClNO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 289.7353

Ref: IN-DA005Y8M