CymitQuimica logo

CAS 73096-37-4

:

N-[3-(2H-Tetrazol-5-yl)phenyl]acetamide

Description:
N-[3-(2H-Tetrazol-5-yl)phenyl]acetamide, with the CAS number 73096-37-4, is a chemical compound characterized by its unique structure that includes a tetrazole ring and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the tetrazole moiety often imparts significant pharmacological properties, making it of interest in medicinal chemistry, particularly for its potential as an antimicrobial or anti-inflammatory agent. The acetamide group enhances solubility and stability, which can influence the compound's reactivity and interaction with biological targets. Additionally, the compound may exhibit moderate to high polarity due to the functional groups present, affecting its behavior in various solvents. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research settings to explore its applications in drug development or as a biochemical probe. Overall, N-[3-(2H-Tetrazol-5-yl)phenyl]acetamide represents a versatile compound with potential implications in various scientific fields.
Formula:C9H9N5O
InChI:InChI=1/C9H9N5O/c1-6(15)10-8-4-2-3-7(5-8)9-11-13-14-12-9/h2-5H,1H3,(H,10,15)(H,11,12,13,14)
InChI key:InChIKey=NWLOCYNIBLCCCR-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C(C=CC1)C=2NN=NN2
Synonyms:
  • Acetamide, N-[3-(1H-tetrazol-5-yl)phenyl]-
  • N-[3-(2H-Tetrazol-5-yl)phenyl]acetamide
  • Acetamide, N-[3-(2H-tetrazol-5-yl)phenyl]-
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.