CAS 73096-39-6
:3-(1H-Tetrazol-5-yl)benzoic acid
Description:
3-(1H-Tetrazol-5-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a tetrazole ring. The presence of the tetrazole group imparts notable properties, such as increased acidity and potential for hydrogen bonding, which can enhance its reactivity and solubility in various solvents. This compound typically exhibits good thermal stability and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. It is often utilized in medicinal chemistry and materials science due to its bioactive properties and ability to form coordination complexes with metals. The compound's molecular structure allows for diverse applications, including its use as a building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, its ability to interact with biological targets makes it a subject of interest in drug discovery and development. Overall, 3-(1H-Tetrazol-5-yl)benzoic acid is a versatile compound with significant potential in various scientific fields.
Formula:C8H6N4O2
InChI:InChI=1/C8H6N4O2/c13-8(14)6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H,(H,13,14)(H,9,10,11,12)
SMILES:c1cc(cc(c1)C(=O)O)c1n[nH]nn1
Synonyms:- benzoic acid, 3-(2H-tetrazol-5-yl)-
- 3-(2H-tetrazol-5-yl)benzoic acid
- 3-(2H-1,2,3,4-tetrazol-5-yl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(1H-Tetrazol-5-yl)benzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6N4O2Purity:97%Color and Shape:White, PowderMolecular weight:190.163-(1H-Tetrazol-5-yl)benzoic Acid
CAS:Formula:C8H6N4O2Purity:97%Color and Shape:SolidMolecular weight:190.15883-(1H-Tetrazol-5-yl)benzoic acid
CAS:3-(1H-Tetrazol-5-yl)benzoic acidPurity:97%Molecular weight:190.16g/mol3-(1H-Tetrazol-5-yl)benzoic Acid
CAS:Controlled ProductApplications 3-(1H-Tetrazol-5-yl)benzoic Acid is a useful reactant in organic synthesis.
References Ouellette, Wayne, et al.: Inorganica Chimica Acta, 391, 36-43 (2012);Ramachandran, Sreekanth A., et al.: Bioorg. & Med. Chem. Let., 27(10), 2153-2160 (2017)Formula:C8H6N4O2Color and Shape:White To Off-WhiteMolecular weight:190.16




