CAS 730964-62-2
:1-Fluoro-2-(2-isocyanoethyl)benzene
Description:
1-Fluoro-2-(2-isocyanoethyl)benzene, with the CAS number 730964-62-2, is an organic compound characterized by the presence of a fluorine atom and an isocyanoethyl group attached to a benzene ring. The fluorine substitution typically enhances the compound's reactivity and can influence its physical properties, such as boiling and melting points. The isocyanoethyl group introduces a functional moiety that can participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry. The presence of both the fluorine and isocyano groups suggests that this compound may exhibit unique electronic properties, which could be leveraged in applications such as pharmaceuticals or materials science. Additionally, the compound's structure may allow for interactions with biological systems, warranting further investigation into its potential biological activity. As with many organic compounds, safety and handling precautions should be observed due to the potential toxicity associated with isocyanides and halogenated compounds.
Formula:C9H8FN
InChI:InChI=1S/C9H8FN/c1-11-7-6-8-4-2-3-5-9(8)10/h2-5H,6-7H2
InChI key:InChIKey=SUKNCHUYYFFYEV-UHFFFAOYSA-N
SMILES:C(C[N+]#[C-])C1=C(F)C=CC=C1
Synonyms:- 2-(2-Fluorophenyl)ethyl isocyanide
- Benzene, 1-fluoro-2-(2-isocyanoethyl)-
- 1-Fluoro-2-(2-isocyanoethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.