CAS 730964-63-3
:1-fluoro-3-(2-isocyanoethyl)benzene
Description:
1-Fluoro-3-(2-isocyanoethyl)benzene, with the CAS number 730964-63-3, is an organic compound characterized by the presence of a fluorine atom and an isocyanoethyl group attached to a benzene ring. The fluorine atom is known for its electronegativity, which can influence the compound's reactivity and polarity. The isocyanoethyl group introduces a functional group that can participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry. The structure suggests that it may exhibit unique properties such as specific solubility characteristics, reactivity patterns, and potential applications in materials science or medicinal chemistry. Additionally, the presence of both the fluorine and isocyano groups may contribute to the compound's overall stability and interaction with biological systems. However, detailed studies would be necessary to fully understand its physical and chemical properties, including boiling point, melting point, and reactivity under various conditions.
Formula:C9H8FN
InChI:InChI=1/C9H8FN/c1-11-6-5-8-3-2-4-9(10)7-8/h2-4,7H,5-6H2
SMILES:[C-]#[N+]CCc1cccc(c1)F
Synonyms:- 2-(3-Fluorophenyl)ethyl isocyanide
- Benzene, 1-fluoro-3-(2-isocyanoethyl)-
- 1-Fluoro-3-(2-isocyanoethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.