CAS 730976-59-7

2,4-Diethyl 5-amino-3-[[(1,1-dimethylethyl)amino]methyl]-2,4-thiophenedicarboxylate

Description:

2,4-Diethyl 5-amino-3-[[(1,1-dimethylethyl)amino]methyl]-2,4-thiophenedicarboxylate is a complex organic compound characterized by its thiophene core, which is a five-membered aromatic ring containing sulfur. This compound features multiple functional groups, including carboxylate esters and an amino group, which contribute to its reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The presence of ethyl groups enhances its lipophilicity, potentially influencing its solubility and biological activity. The tert-butylamino substituent may provide steric hindrance, affecting the compound's interaction with biological targets. As with many organic compounds, its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Safety and handling precautions are essential, as the compound may exhibit toxicity or other hazardous characteristics. Overall, this compound's unique structure suggests potential utility in synthetic chemistry and medicinal applications, warranting further investigation into its properties and effects.

Formula: C₁₅H₂₄N₂O₄S

InChI: InChI=1S/C15H24N2O4S/c1-6-20-13(18)10-9(8-17-15(3,4)5)11(22-12(10)16)14(19)21-7-2/h17H,6-8,16H2,1-5H3

InChI key: InChIKey=RDKPGRITPXZEDP-UHFFFAOYSA-N

SMILES: C(NC(C)(C)C)C1=C(C(OCC)=O)SC(N)=C1C(OCC)=O

Synonyms:

• 2,4-Thiophenedicarboxylic acid, 5-amino-3-[[(1,1-dimethylethyl)amino]methyl]-, diethyl ester
• 2,4-Diethyl 5-amino-3-[[(1,1-dimethylethyl)amino]methyl]-2,4-thiophenedicarboxylate
• 2,4-Thiophenedicarboxylic acid, 5-amino-3-[[(1,1-dimethylethyl)amino]methyl]-, 2,4-diethyl ester