CymitQuimica logo

CAS 730979-32-5

:

N2-[(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1S)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine

Description:
The chemical substance known as N2-[(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1S)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine, with the CAS number 730979-32-5, is a complex organic compound characterized by its unique structural features. It contains a triazine ring, which is a six-membered heterocyclic compound with three nitrogen atoms, contributing to its potential biological activity. The presence of the indene moiety, specifically the 2,3-dihydro-2,6-dimethyl-1H-inden-1-yl group, suggests that it may exhibit interesting stereochemical properties due to its chiral centers. Additionally, the incorporation of a fluoroethyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential activity against specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be further elucidated through spectroscopic methods and biological assays.
Formula:C16H20FN5
InChI:InChI=1S/C16H20FN5/c1-8-4-5-11-7-9(2)13(12(11)6-8)19-16-21-14(10(3)17)20-15(18)22-16/h4-6,9-10,13H,7H2,1-3H3,(H3,18,19,20,21,22)/t9-,10-,13+/m0/s1
InChI key:InChIKey=YFONKFDEZLYQDH-OUJBWJOFSA-N
SMILES:N([C@H]1C=2C(C[C@@H]1C)=CC=C(C)C2)C=3N=C([C@H](C)F)N=C(N)N3
Synonyms:
  • 1,3,5-Triazine-2,4-diamine, N-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1S)-1-fluoroethyl]-
  • N2-[(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1S)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine
  • 1,3,5-Triazine-2,4-diamine, N2-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1S)-1-fluoroethyl]-
  • N-[(1R,2S)-2,6-dimethyindan-1-yl]-6-[(1S)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.